C20H32O5 — CID 58077826
(S)-1,4-dioxaspiro[4.5]decan-3-yl-[(2S)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol (PubChem CID 58077826) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (S)-1,4-dioxaspiro[4.5]decan-3-yl-[(2S)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol.
| Compound Name | (S)-1,4-dioxaspiro[4.5]decan-3-yl-[(2S)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol |
|---|---|
| PubChem CID | 58077826 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (S)-1,4-dioxaspiro[4.5]decan-3-yl-[(2S)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol |
| SMILES | C/C=C/[C@@H]1OC2(CCCCC2)OC1[C@@H](O)C1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H32O5/c1-2-9-15-18(25-20(23-15)12-7-4-8-13-20)17(21)16-14-22-19(24-16)10-5-3-6-11-19/h2,9,15-18,21H,3-8,10-14H2,1H3/b9-2+/t15-,16?,17-,18?/m0/s1 |
| InChIKey | HCJYHRYCNJMUCW-HSJGIDPYSA-N |
| XLogP | 3.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|