C22H38O5Si — CID 58077829
(E)-1-[(1S,2S,7S,9S,12S)-12-ethylspiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-7-yl]-3-trimethylsilylprop-2-en-1-ol (PubChem CID 58077829) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (E)-1-[(1S,2S,7S,9S,12S)-12-ethylspiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-7-yl]-3-trimethylsilylprop-2-en-1-ol.
| Compound Name | (E)-1-[(1S,2S,7S,9S,12S)-12-ethylspiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-7-yl]-3-trimethylsilylprop-2-en-1-ol |
|---|---|
| PubChem CID | 58077829 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (E)-1-[(1S,2S,7S,9S,12S)-12-ethylspiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-7-yl]-3-trimethylsilylprop-2-en-1-ol |
| SMILES | CC[C@H]1CC[C@@H]2O[C@@H](C(O)/C=C/[Si](C)(C)C)C3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C22H38O5Si/c1-5-15-9-10-17-19(24-15)21-20(26-22(27-21)12-7-6-8-13-22)18(25-17)16(23)11-14-28(2,3)4/h11,14-21,23H,5-10,12-13H2,1-4H3/b14-11+/t15-,16?,17-,18-,19-,20?,21-/m0/s1 |
| InChIKey | LAKHGQNPAJVRPC-UASIBKDUSA-N |
| XLogP | 3.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|