C9H14O — CID 58077971
(1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane (PubChem CID 58077971) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 58077971 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane |
| SMILES | C1C[C@H]2C[C@@H]1[C@H]1COC[C@@H]21 |
| InChI | InChI=1S/C9H14O/c1-2-7-3-6(1)8-4-10-5-9(7)8/h6-9H,1-5H2/t6-,7+,8-,9+ |
| InChIKey | CGRKFVNKMZHBCO-SPJNRGJMSA-N |
| XLogP | 1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |