About 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol
8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol (PubChem CID 58078025) has the molecular formula C36H37NOS3
and a molecular weight of 595.90 g/mol. Its IUPAC name is 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol.
Molecular Properties
| Compound Name | 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol |
| PubChem CID | 58078025 |
| Molecular Formula | C36H37NOS3 |
| Molecular Weight | 595.90 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)s4)ccc2n3-c2ccc(OCCCCCCCCS)cc2)s1 |
| InChI | InChI=1S/C36H37NOS3/c1-25-9-19-35(40-25)27-11-17-33-31(23-27)32-24-28(36-20-10-26(2)41-36)12-18-34(32)37(33)29-13-15-30(16-14-29)38-21-7-5-3-4-6-8-22-39/h9-20,23-24,39H,3-8,21-22H2,1-2H3 |
| InChIKey | FQPUZZOCBHCEEL-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 14.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.90 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol?
The IUPAC name of 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol (CID 58078025) is 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol.
What is the SMILES notation for 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol?
The canonical SMILES for 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol is Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)s4)ccc2n3-c2ccc(OCCCCCCCCS)cc2)s1.
What is the InChIKey of 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol?
The InChIKey is FQPUZZOCBHCEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H37NOS3/c1-25-9-19-35(40-25)27-11-17-33-31(23-27)32-24-28(36-20-10-26(2)41-36)12-18-34(32)37(33)29-13-15-30(16-14-29)38-21-7-5-3-4-6-8-22-39/h9-20,23-24,39H,3-8,21-22H2,1-2H3.
What are the key properties of 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol?
8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol has a molecular weight of 595.90 g/mol, XLogP of 11.51, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-[3,6-bis(5-methylthiophen-2-yl)carbazol-9-yl]phenoxy]octane-1-thiol is sourced from PubChem (CID 58078025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).