C42H45Br2N3S2 — CID 58078182
2,4-bis(tert-butylsulfanyl)-6-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]-1,3,5-triazine (PubChem CID 58078182) has the molecular formula C42H45Br2N3S2 and a molecular weight of 815.78 g/mol. Its IUPAC name is 2,4-bis(tert-butylsulfanyl)-6-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(tert-butylsulfanyl)-6-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58078182 |
| Molecular Formula | C42H45Br2N3S2 |
| Molecular Weight | 815.78 g/mol |
| Exact Mass | 813.14 |
| IUPAC Name | 2,4-bis(tert-butylsulfanyl)-6-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(C2(c3ccc(-c4nc(SC(C)(C)C)nc(SC(C)(C)C)n4)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C42H45Br2N3S2/c1-8-9-10-11-12-27-13-17-29(18-14-27)42(35-25-31(43)21-23-33(35)34-24-22-32(44)26-36(34)42)30-19-15-28(16-20-30)37-45-38(48-40(2,3)4)47-39(46-37)49-41(5,6)7/h13-26H,8-12H2,1-7H3 |
| InChIKey | CVFMRUUEMXZTNO-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.78 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|