C30H49N3O3Si2 — CID 58078496
4-[[(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde (PubChem CID 58078496) has the molecular formula C30H49N3O3Si2 and a molecular weight of 555.91 g/mol. Its IUPAC name is 4-[[(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde.
| Compound Name | 4-[[(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 58078496 |
| Molecular Formula | C30H49N3O3Si2 |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | 4-[[(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-2-adamantyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC12CC3C[C@H](C1)C(Nc1c(C=O)cnc4c1ccn4COCC[Si](C)(C)C)[C@@H](C3)C2 |
| InChI | InChI=1S/C30H49N3O3Si2/c1-29(2,3)38(7,8)36-30-15-21-13-22(16-30)26(23(14-21)17-30)32-27-24(19-34)18-31-28-25(27)9-10-33(28)20-35-11-12-37(4,5)6/h9-10,18-19,21-23,26H,11-17,20H2,1-8H3,(H,31,32)/t21?,22-,23+,26?,30? |
| InChIKey | OPXMHJUWGYDWGP-XTAVCKNTSA-N |
| XLogP | 7.54 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|