C27H27N3O2S — CID 58078561
1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one (PubChem CID 58078561) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one.
| Compound Name | 1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one |
|---|---|
| PubChem CID | 58078561 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[(3R,4R)-3-(3,8-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)-4-methylpiperidin-1-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one |
| SMILES | C[C@@H]1CCN(C(=O)CCc2ccc(-c3cccs3)o2)C[C@@H]1n1ccc2cnc3c(c21)C=CC3 |
| InChI | InChI=1S/C27H27N3O2S/c1-18-11-13-29(26(31)10-8-20-7-9-24(32-20)25-6-3-15-33-25)17-23(18)30-14-12-19-16-28-22-5-2-4-21(22)27(19)30/h2-4,6-7,9,12,14-16,18,23H,5,8,10-11,13,17H2,1H3/t18-,23+/m1/s1 |
| InChIKey | OQKBCHQXTHWNJX-JPYJTQIMSA-N |
| XLogP | 5.97 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |