C27H36N4OSi — CID 58078572
2-[[3-(1-benzylpiperidin-4-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58078572) has the molecular formula C27H36N4OSi and a molecular weight of 460.70 g/mol. Its IUPAC name is 2-[[3-(1-benzylpiperidin-4-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(1-benzylpiperidin-4-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58078572 |
| Molecular Formula | C27H36N4OSi |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2-[[3-(1-benzylpiperidin-4-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1ccn(C3CCN(Cc4ccccc4)CC3)c12 |
| InChI | InChI=1S/C27H36N4OSi/c1-33(2,3)18-17-32-21-30-15-12-25-26-23(19-28-27(25)30)9-16-31(26)24-10-13-29(14-11-24)20-22-7-5-4-6-8-22/h4-9,12,15-16,19,24H,10-11,13-14,17-18,20-21H2,1-3H3 |
| InChIKey | VHFCODRFIVNVJP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|