C21H31BrN4OSi — CID 58078613
2-[[5-bromo-3-[(3R,4R)-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58078613) has the molecular formula C21H31BrN4OSi and a molecular weight of 463.50 g/mol. Its IUPAC name is 2-[[5-bromo-3-[(3R,4R)-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-3-[(3R,4R)-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58078613 |
| Molecular Formula | C21H31BrN4OSi |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[[5-bromo-3-[(3R,4R)-4-methylpiperidin-3-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[C@@H]1CCNC[C@@H]1n1cc(Br)c2cnc3c(ccn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C21H31BrN4OSi/c1-15-5-7-23-12-19(15)26-13-18(22)17-11-24-21-16(20(17)26)6-8-25(21)14-27-9-10-28(2,3)4/h6,8,11,13,15,19,23H,5,7,9-10,12,14H2,1-4H3/t15-,19+/m1/s1 |
| InChIKey | ARDSPBASDAJCLZ-BEFAXECRSA-N |
| XLogP | 5.24 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|