C20H23N5O3Si — CID 58078630
trimethyl-[2-[[3-(5-nitro-2-pyridinyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl]silane (PubChem CID 58078630) has the molecular formula C20H23N5O3Si and a molecular weight of 409.52 g/mol. Its IUPAC name is trimethyl-[2-[[3-(5-nitro-2-pyridinyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-(5-nitro-2-pyridinyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 58078630 |
| Molecular Formula | C20H23N5O3Si |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | trimethyl-[2-[[3-(5-nitro-2-pyridinyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1ccn(-c3ccc([N+](=O)[O-])cn3)c12 |
| InChI | InChI=1S/C20H23N5O3Si/c1-29(2,3)11-10-28-14-23-8-7-17-19-15(12-22-20(17)23)6-9-24(19)18-5-4-16(13-21-18)25(26)27/h4-9,12-13H,10-11,14H2,1-3H3 |
| InChIKey | XRFLBDRWDHSAJT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|