C27H37N5OSi — CID 58078665
4-[[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 58078665) has the molecular formula C27H37N5OSi and a molecular weight of 475.71 g/mol. Its IUPAC name is 4-[[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4-[[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 58078665 |
| Molecular Formula | C27H37N5OSi |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 4-[[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1Nc1c(C#N)cnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H37N5OSi/c1-21-10-12-31(18-22-8-6-5-7-9-22)19-25(21)30-26-23(16-28)17-29-27-24(26)11-13-32(27)20-33-14-15-34(2,3)4/h5-9,11,13,17,21,25H,10,12,14-15,18-20H2,1-4H3,(H,29,30)/t21-,25+/m1/s1 |
| InChIKey | ZKWQNFHQRMWIQF-BWKNWUBXSA-N |
| XLogP | 5.54 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|