C29H40N4OSi — CID 58078734
2-[[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-methyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58078734) has the molecular formula C29H40N4OSi and a molecular weight of 488.75 g/mol. Its IUPAC name is 2-[[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-methyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-methyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58078734 |
| Molecular Formula | C29H40N4OSi |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 2-[[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-4-methyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc2cnc3c(ccn3COCC[Si](C)(C)C)c2n1[C@H]1CN(Cc2ccccc2)CC[C@H]1C |
| InChI | InChI=1S/C29H40N4OSi/c1-22-11-13-31(19-24-9-7-6-8-10-24)20-27(22)33-23(2)17-25-18-30-29-26(28(25)33)12-14-32(29)21-34-15-16-35(3,4)5/h6-10,12,14,17-18,22,27H,11,13,15-16,19-21H2,1-5H3/t22-,27+/m1/s1 |
| InChIKey | ILGQRWSALUXVTB-AMGIVPHBSA-N |
| XLogP | 6.69 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|