C26H39BrN4O3Si — CID 58078738
tert-butyl (3R,4R)-3-[5-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylate (PubChem CID 58078738) has the molecular formula C26H39BrN4O3Si and a molecular weight of 563.61 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[5-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[5-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58078738 |
| Molecular Formula | C26H39BrN4O3Si |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | tert-butyl (3R,4R)-3-[5-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1n1cc(Br)c2cnc3c(ccn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C26H39BrN4O3Si/c1-18-8-10-29(25(32)34-26(2,3)4)16-22(18)31-15-21(27)20-14-28-24-19(23(20)31)9-11-30(24)17-33-12-13-35(5,6)7/h9,11,14-15,18,22H,8,10,12-13,16-17H2,1-7H3/t18-,22+/m1/s1 |
| InChIKey | XMLKNDWZKWYJJJ-GCJKJVERSA-N |
| XLogP | 6.88 |
| TPSA | 61.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|