C31H45N5OSi — CID 58078742
1-[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-12-yl]-N,N-dimethylmethanamine (PubChem CID 58078742) has the molecular formula C31H45N5OSi and a molecular weight of 531.82 g/mol. Its IUPAC name is 1-[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-12-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-12-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 58078742 |
| Molecular Formula | C31H45N5OSi |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 531.34 |
| IUPAC Name | 1-[3-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-12-yl]-N,N-dimethylmethanamine |
| SMILES | C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1n1ccc2cnc3c(c(CN(C)C)cn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C31H45N5OSi/c1-24-12-14-34(19-25-10-8-7-9-11-25)22-28(24)36-15-13-26-18-32-31-29(30(26)36)27(20-33(2)3)21-35(31)23-37-16-17-38(4,5)6/h7-11,13,15,18,21,24,28H,12,14,16-17,19-20,22-23H2,1-6H3/t24-,28+/m1/s1 |
| InChIKey | OSAUTIUYLNSBCE-YWEHKCAJSA-N |
| XLogP | 6.45 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|