C39H76O9Si2 — CID 58078850
5-O-butyl 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 3-O-(3-ethylheptyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate (PubChem CID 58078850) has the molecular formula C39H76O9Si2 and a molecular weight of 745.20 g/mol. Its IUPAC name is 5-O-butyl 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 3-O-(3-ethylheptyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate.
| Compound Name | 5-O-butyl 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 3-O-(3-ethylheptyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 58078850 |
| Molecular Formula | C39H76O9Si2 |
| Molecular Weight | 745.20 g/mol |
| Exact Mass | 744.50 |
| IUPAC Name | 5-O-butyl 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 3-O-(3-ethylheptyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate |
| SMILES | CCCCOC(=O)C(C)(CC(CC(C)(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)C)C(=O)OCCC(CC)CCCC)CC(C)(CC)C(=O)OC |
| InChI | InChI=1S/C39H76O9Si2/c1-15-19-22-31(17-3)23-26-45-33(40)32(28-37(5,6)34(41)46-25-21-27-50(13,14)48-49(10,11)12)29-39(8,36(43)47-24-20-16-2)30-38(7,18-4)35(42)44-9/h31-32H,15-30H2,1-14H3 |
| InChIKey | KBQJRAGQPQNULO-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.20 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|