C18H12F4O7S — CID 58078955
2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-(2-phenylethoxy)but-2-enoyl]oxybenzenesulfonic acid (PubChem CID 58078955) has the molecular formula C18H12F4O7S and a molecular weight of 448.35 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-(2-phenylethoxy)but-2-enoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-(2-phenylethoxy)but-2-enoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58078955 |
| Molecular Formula | C18H12F4O7S |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(Z)-4-oxo-4-(2-phenylethoxy)but-2-enoyl]oxybenzenesulfonic acid |
| SMILES | O=C(/C=C\C(=O)Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)OCCc1ccccc1 |
| InChI | InChI=1S/C18H12F4O7S/c19-13-15(21)18(30(25,26)27)16(22)14(20)17(13)29-12(24)7-6-11(23)28-9-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,25,26,27)/b7-6- |
| InChIKey | GLQMMSAHEXCFNG-SREVYHEPSA-N |
| XLogP | 2.74 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|