About [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate
[[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate (PubChem CID 58078968) has the molecular formula C10H10F3NO3S
and a molecular weight of 281.26 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate.
Molecular Properties
| Compound Name | [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate |
| PubChem CID | 58078968 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate |
| SMILES | Cc1ccc(C(=NOS(C)(=O)=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO3S/c1-7-3-5-8(6-4-7)9(10(11,12)13)14-17-18(2,15)16/h3-6H,1-2H3 |
| InChIKey | HKTJEXSBIFCXSX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate?
The IUPAC name of [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate (CID 58078968) is [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate.
What is the SMILES notation for [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate?
The canonical SMILES for [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate is Cc1ccc(C(=NOS(C)(=O)=O)C(F)(F)F)cc1.
What is the InChIKey of [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate?
The InChIKey is HKTJEXSBIFCXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3S/c1-7-3-5-8(6-4-7)9(10(11,12)13)14-17-18(2,15)16/h3-6H,1-2H3.
What are the key properties of [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate?
[[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate has a molecular weight of 281.26 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate is sourced from PubChem (CID 58078968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).