C20H23F2N3O — CID 58079280
3-(difluoromethyl)-1-methyl-N-[(1S,8R,11R)-11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]pyrazole-4-carboxamide (PubChem CID 58079280) has the molecular formula C20H23F2N3O and a molecular weight of 359.42 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-N-[(1S,8R,11R)-11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-N-[(1S,8R,11R)-11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 58079280 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N-[(1S,8R,11R)-11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]pyrazole-4-carboxamide |
| SMILES | CC(C)[C@H]1[C@@H]2CC[C@H]1c1cccc(NC(=O)c3cn(C)nc3C(F)F)c12 |
| InChI | InChI=1S/C20H23F2N3O/c1-10(2)16-12-7-8-13(16)17-11(12)5-4-6-15(17)23-20(26)14-9-25(3)24-18(14)19(21)22/h4-6,9-10,12-13,16,19H,7-8H2,1-3H3,(H,23,26)/t12-,13-,16+/m0/s1 |
| InChIKey | XTDZGXBTXBEZDN-HEHGZKQESA-N |
| XLogP | 4.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |