About 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane
2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane (PubChem CID 58079293) has the molecular formula C10H12F2OS
and a molecular weight of 218.27 g/mol. Its IUPAC name is 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane.
Molecular Properties
| Compound Name | 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane |
| PubChem CID | 58079293 |
| Molecular Formula | C10H12F2OS |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane |
| SMILES | CC(CF)(CF)C1(c2cccs2)CO1 |
| InChI | InChI=1S/C10H12F2OS/c1-9(5-11,6-12)10(7-13-10)8-3-2-4-14-8/h2-4H,5-7H2,1H3 |
| InChIKey | XQSKTNBPBIUPGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane?
The IUPAC name of 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane (CID 58079293) is 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane.
What is the SMILES notation for 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane?
The canonical SMILES for 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane is CC(CF)(CF)C1(c2cccs2)CO1.
What is the InChIKey of 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane?
The InChIKey is XQSKTNBPBIUPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2OS/c1-9(5-11,6-12)10(7-13-10)8-3-2-4-14-8/h2-4H,5-7H2,1H3.
What are the key properties of 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane?
2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane has a molecular weight of 218.27 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-difluoro-2-methylpropan-2-yl)-2-thiophen-2-yloxirane is sourced from PubChem (CID 58079293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).