C22H21Cl3FN3O2 — CID 58079754
N-ethyl-3-fluoro-3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-1-carboxamide (PubChem CID 58079754) has the molecular formula C22H21Cl3FN3O2 and a molecular weight of 484.79 g/mol. Its IUPAC name is N-ethyl-3-fluoro-3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-1-carboxamide.
| Compound Name | N-ethyl-3-fluoro-3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 58079754 |
| Molecular Formula | C22H21Cl3FN3O2 |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-ethyl-3-fluoro-3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-1-carboxamide |
| SMILES | CCNC(=O)N1CC(F)(c2ccc(C3=NOC(C)(c4cc(Cl)c(Cl)c(Cl)c4)C3)cc2)C1 |
| InChI | InChI=1S/C22H21Cl3FN3O2/c1-3-27-20(30)29-11-22(26,12-29)14-6-4-13(5-7-14)18-10-21(2,31-28-18)15-8-16(23)19(25)17(24)9-15/h4-9H,3,10-12H2,1-2H3,(H,27,30) |
| InChIKey | LIJRVGUVJBEAMU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|