C21H19Cl3N2O2 — CID 58079803
1-[3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-1-yl]ethanone (PubChem CID 58079803) has the molecular formula C21H19Cl3N2O2 and a molecular weight of 437.75 g/mol. Its IUPAC name is 1-[3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58079803 |
| Molecular Formula | C21H19Cl3N2O2 |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1-[3-[4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(c2ccc(C3=NOC(C)(c4cc(Cl)c(Cl)c(Cl)c4)C3)cc2)C1 |
| InChI | InChI=1S/C21H19Cl3N2O2/c1-12(27)26-10-15(11-26)13-3-5-14(6-4-13)19-9-21(2,28-25-19)16-7-17(22)20(24)18(23)8-16/h3-8,15H,9-11H2,1-2H3 |
| InChIKey | DSEFVHRORCFZRI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|