C32H26BrCl3N2O2 — CID 58079807
1-benzhydryl-3-[2-bromo-4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol (PubChem CID 58079807) has the molecular formula C32H26BrCl3N2O2 and a molecular weight of 656.84 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-bromo-4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol.
| Compound Name | 1-benzhydryl-3-[2-bromo-4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 58079807 |
| Molecular Formula | C32H26BrCl3N2O2 |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | 1-benzhydryl-3-[2-bromo-4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
| SMILES | CC1(c2cc(Cl)c(Cl)c(Cl)c2)CC(c2ccc(C3(O)CN(C(c4ccccc4)c4ccccc4)C3)c(Br)c2)=NO1 |
| InChI | InChI=1S/C32H26BrCl3N2O2/c1-31(23-15-26(34)29(36)27(35)16-23)17-28(37-40-31)22-12-13-24(25(33)14-22)32(39)18-38(19-32)30(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-16,30,39H,17-19H2,1H3 |
| InChIKey | SXQNUBRQCSGRQF-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|