C24H31ClN2O3 — CID 58080624
3-(benzylamino)-N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-N-(2-methylpropyl)propanamide (PubChem CID 58080624) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is 3-(benzylamino)-N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-N-(2-methylpropyl)propanamide.
| Compound Name | 3-(benzylamino)-N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 58080624 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-(benzylamino)-N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CN(Cc1cc(Cl)c2c(c1)OCCCO2)C(=O)CCNCc1ccccc1 |
| InChI | InChI=1S/C24H31ClN2O3/c1-18(2)16-27(23(28)9-10-26-15-19-7-4-3-5-8-19)17-20-13-21(25)24-22(14-20)29-11-6-12-30-24/h3-5,7-8,13-14,18,26H,6,9-12,15-17H2,1-2H3 |
| InChIKey | ZUTHMXOBWMDNFP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|