C24H23F3N6O2 — CID 58080732
1-[3-[7-[5-(1H-imidazol-5-yl)pentanoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 58080732) has the molecular formula C24H23F3N6O2 and a molecular weight of 484.48 g/mol. Its IUPAC name is 1-[3-[7-[5-(1H-imidazol-5-yl)pentanoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[5-(1H-imidazol-5-yl)pentanoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 58080732 |
| Molecular Formula | C24H23F3N6O2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1-[3-[7-[5-(1H-imidazol-5-yl)pentanoyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(C(=O)CCCCc4cnc[nH]4)ccn23)c1 |
| InChI | InChI=1S/C24H23F3N6O2/c25-24(26,27)14-30-23(35)32-18-6-3-4-16(10-18)20-13-29-22-11-17(8-9-33(20)22)21(34)7-2-1-5-19-12-28-15-31-19/h3-4,6,8-13,15H,1-2,5,7,14H2,(H,28,31)(H2,30,32,35) |
| InChIKey | HGYIQNPQJXEKAW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|