C23H27Cl2N5O5 — CID 58080760
methyl (2S)-2-[[[[(3S)-3-acetyloxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]methyl]-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-4-oxobutanoate (PubChem CID 58080760) has the molecular formula C23H27Cl2N5O5 and a molecular weight of 524.41 g/mol. Its IUPAC name is methyl (2S)-2-[[[[(3S)-3-acetyloxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]methyl]-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-4-oxobutanoate.
| Compound Name | methyl (2S)-2-[[[[(3S)-3-acetyloxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]methyl]-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 58080760 |
| Molecular Formula | C23H27Cl2N5O5 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | methyl (2S)-2-[[[[(3S)-3-acetyloxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]methyl]-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-4-oxobutanoate |
| SMILES | [C-]#[N+]N/C(=N\C[C@H](CC(=O)c1c(Cl)cc2c(c1Cl)CCNC2)C(=O)OC)N1CC[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C23H27Cl2N5O5/c1-13(31)35-16-5-7-30(12-16)23(29-26-2)28-11-15(22(33)34-3)9-19(32)20-18(24)8-14-10-27-6-4-17(14)21(20)25/h8,15-16,27H,4-7,9-12H2,1,3H3,(H,28,29)/t15-,16-/m0/s1 |
| InChIKey | UCMNEJHVSKPRBS-HOTGVXAUSA-N |
| XLogP | 2.42 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|