C27H37N3OS — CID 58080967
N-[2-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperidin-1-yl]ethyl]butanamide (PubChem CID 58080967) has the molecular formula C27H37N3OS and a molecular weight of 451.68 g/mol. Its IUPAC name is N-[2-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperidin-1-yl]ethyl]butanamide.
| Compound Name | N-[2-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperidin-1-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 58080967 |
| Molecular Formula | C27H37N3OS |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | N-[2-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperidin-1-yl]ethyl]butanamide |
| SMILES | CCCC(=O)NCCN1CCC(CCCN2c3ccccc3Sc3ccc(C)cc32)CC1 |
| InChI | InChI=1S/C27H37N3OS/c1-3-7-27(31)28-15-19-29-17-13-22(14-18-29)8-6-16-30-23-9-4-5-10-25(23)32-26-12-11-21(2)20-24(26)30/h4-5,9-12,20,22H,3,6-8,13-19H2,1-2H3,(H,28,31) |
| InChIKey | CQKOAXHUTZYDHF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |