About ethyl 2H-pyrrole-4-carboxylate
ethyl 2H-pyrrole-4-carboxylate (PubChem CID 58081160) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is ethyl 2H-pyrrole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2H-pyrrole-4-carboxylate |
| PubChem CID | 58081160 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | ethyl 2H-pyrrole-4-carboxylate |
| SMILES | CCOC(=O)C1=CCN=C1 |
| InChI | InChI=1S/C7H9NO2/c1-2-10-7(9)6-3-4-8-5-6/h3,5H,2,4H2,1H3 |
| InChIKey | BUGGPVYYLIPZNJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2H-pyrrole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2H-pyrrole-4-carboxylate?
The IUPAC name of ethyl 2H-pyrrole-4-carboxylate (CID 58081160) is ethyl 2H-pyrrole-4-carboxylate.
What is the SMILES notation for ethyl 2H-pyrrole-4-carboxylate?
The canonical SMILES for ethyl 2H-pyrrole-4-carboxylate is CCOC(=O)C1=CCN=C1.
What is the InChIKey of ethyl 2H-pyrrole-4-carboxylate?
The InChIKey is BUGGPVYYLIPZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-2-10-7(9)6-3-4-8-5-6/h3,5H,2,4H2,1H3.
What are the key properties of ethyl 2H-pyrrole-4-carboxylate?
ethyl 2H-pyrrole-4-carboxylate has a molecular weight of 139.15 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2H-pyrrole-4-carboxylate is sourced from PubChem (CID 58081160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).