C23H27N7O — CID 58081259
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(1,2,3-trimethylindol-5-yl)methyl]triazole-4-carboxamide (PubChem CID 58081259) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(1,2,3-trimethylindol-5-yl)methyl]triazole-4-carboxamide.
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(1,2,3-trimethylindol-5-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 58081259 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(1,2,3-trimethylindol-5-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1cc(N)nc(C)c1CNC(=O)c1cn(Cc2ccc3c(c2)c(C)c(C)n3C)nn1 |
| InChI | InChI=1S/C23H27N7O/c1-13-8-22(24)26-15(3)19(13)10-25-23(31)20-12-30(28-27-20)11-17-6-7-21-18(9-17)14(2)16(4)29(21)5/h6-9,12H,10-11H2,1-5H3,(H2,24,26)(H,25,31) |
| InChIKey | KXTIOXUGQMYWJG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|