About 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one
3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one (PubChem CID 58081295) has the molecular formula C20H23N5O
and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one |
| PubChem CID | 58081295 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one |
| SMILES | Cc1cc(N)nc(C)c1CCC(=O)c1nnn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C20H23N5O/c1-13-11-19(21)22-14(2)17(13)9-10-18(26)20-15(3)25(24-23-20)12-16-7-5-4-6-8-16/h4-8,11H,9-10,12H2,1-3H3,(H2,21,22) |
| InChIKey | IKUODCLZKBWVPL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one?
The IUPAC name of 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one (CID 58081295) is 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one.
What is the SMILES notation for 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one?
The canonical SMILES for 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one is Cc1cc(N)nc(C)c1CCC(=O)c1nnn(Cc2ccccc2)c1C.
What is the InChIKey of 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one?
The InChIKey is IKUODCLZKBWVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O/c1-13-11-19(21)22-14(2)17(13)9-10-18(26)20-15(3)25(24-23-20)12-16-7-5-4-6-8-16/h4-8,11H,9-10,12H2,1-3H3,(H2,21,22).
What are the key properties of 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one?
3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one has a molecular weight of 349.44 g/mol, XLogP of 3.04, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-amino-2,4-dimethyl-3-pyridinyl)-1-(1-benzyl-5-methyltriazol-4-yl)propan-1-one is sourced from PubChem (CID 58081295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).