C27H32F3N5O2 — CID 58081464
5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081464) has the molecular formula C27H32F3N5O2 and a molecular weight of 515.58 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081464 |
| Molecular Formula | C27H32F3N5O2 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | CN1CCN(CCCO/N=C\c2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C27H32F3N5O2/c1-33-11-13-34(14-12-33)9-3-15-37-32-19-22-7-10-35-25(20-31-26(35)18-22)23-5-2-4-21(16-23)17-24(36)6-8-27(28,29)30/h2,4-5,7,10,16,18-20H,3,6,8-9,11-15,17H2,1H3/b32-19- |
| InChIKey | VSWHNAKNIQSCIO-MZFJOGFUSA-N |
| XLogP | 4.44 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|