C29H35F3N4O3 — CID 58081466
5,5,5-trifluoro-1-[3-[7-[(Z)-2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081466) has the molecular formula C29H35F3N4O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081466 |
| Molecular Formula | C29H35F3N4O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-2-[1-(2-methoxyethyl)piperidin-4-yl]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | COCCN1CCC(CCO/N=C\c2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C29H35F3N4O3/c1-38-16-14-35-11-6-22(7-12-35)9-15-39-34-20-24-8-13-36-27(21-33-28(36)19-24)25-4-2-3-23(17-25)18-26(37)5-10-29(30,31)32/h2-4,8,13,17,19-22H,5-7,9-12,14-16,18H2,1H3/b34-20- |
| InChIKey | IQJWKAJLQGLUBM-GXBUFBABSA-N |
| XLogP | 5.55 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|