C26H29F3N4O2 — CID 58081474
5,5,5-trifluoro-1-[3-[7-[(Z)-3-pyrrolidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081474) has the molecular formula C26H29F3N4O2 and a molecular weight of 486.54 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-3-pyrrolidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-pyrrolidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081474 |
| Molecular Formula | C26H29F3N4O2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-pyrrolidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1cccc(-c2cnc3cc(/C=N\OCCCN4CCCC4)ccn23)c1 |
| InChI | InChI=1S/C26H29F3N4O2/c27-26(28,29)9-7-23(34)16-20-5-3-6-22(15-20)24-19-30-25-17-21(8-13-33(24)25)18-31-35-14-4-12-32-10-1-2-11-32/h3,5-6,8,13,15,17-19H,1-2,4,7,9-12,14,16H2/b31-18- |
| InChIKey | DZVOPXISYZKNRM-MNBJERMJSA-N |
| XLogP | 5.29 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|