C28H35F3N6O4S — CID 58081487
N,N-dimethyl-4-[3-[(E)-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methylideneamino]oxypropyl]piperazine-1-sulfonamide (PubChem CID 58081487) has the molecular formula C28H35F3N6O4S and a molecular weight of 608.69 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[(E)-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methylideneamino]oxypropyl]piperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-[3-[(E)-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methylideneamino]oxypropyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 58081487 |
| Molecular Formula | C28H35F3N6O4S |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | N,N-dimethyl-4-[3-[(E)-[3-[3-(5,5,5-trifluoro-2-oxopentyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methylideneamino]oxypropyl]piperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(CCCO/N=C/c2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C28H35F3N6O4S/c1-34(2)42(39,40)36-14-12-35(13-15-36)10-4-16-41-33-20-23-8-11-37-26(21-32-27(37)19-23)24-6-3-5-22(17-24)18-25(38)7-9-28(29,30)31/h3,5-6,8,11,17,19-21H,4,7,9-10,12-16,18H2,1-2H3/b33-20+ |
| InChIKey | FGYKWWURMRARCN-FMFFXOCNSA-N |
| XLogP | 3.62 |
| TPSA | 99.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|