C25H29F3N4O3 — CID 58081498
5,5,5-trifluoro-1-[3-[7-[(Z)-2-[2-methoxyethyl(methyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081498) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-2-[2-methoxyethyl(methyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-2-[2-methoxyethyl(methyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081498 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-2-[2-methoxyethyl(methyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | COCCN(C)CCO/N=C\c1ccn2c(-c3cccc(CC(=O)CCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C25H29F3N4O3/c1-31(10-12-34-2)11-13-35-30-17-20-7-9-32-23(18-29-24(32)16-20)21-5-3-4-19(14-21)15-22(33)6-8-25(26,27)28/h3-5,7,9,14,16-18H,6,8,10-13,15H2,1-2H3/b30-17- |
| InChIKey | ZJUZFHDCHNWJMU-LQNQUEJISA-N |
| XLogP | 4.38 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|