C29H36F3N5O2 — CID 58081504
5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-propylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081504) has the molecular formula C29H36F3N5O2 and a molecular weight of 543.63 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-propylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-propylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081504 |
| Molecular Formula | C29H36F3N5O2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-propylpiperazin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | CCCN1CCN(CCCO/N=C\c2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C29H36F3N5O2/c1-2-10-35-13-15-36(16-14-35)11-4-17-39-34-21-24-8-12-37-27(22-33-28(37)20-24)25-6-3-5-23(18-25)19-26(38)7-9-29(30,31)32/h3,5-6,8,12,18,20-22H,2,4,7,9-11,13-17,19H2,1H3/b34-21- |
| InChIKey | WRNCPUCJPLFXRO-ZXSNDDASSA-N |
| XLogP | 5.22 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|