C27H31F3N4O2 — CID 58081507
5,5,5-trifluoro-1-[3-[7-[(E)-3-piperidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081507) has the molecular formula C27H31F3N4O2 and a molecular weight of 500.57 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(E)-3-piperidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(E)-3-piperidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081507 |
| Molecular Formula | C27H31F3N4O2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(E)-3-piperidin-1-ylpropoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1cccc(-c2cnc3cc(/C=N/OCCCN4CCCCC4)ccn23)c1 |
| InChI | InChI=1S/C27H31F3N4O2/c28-27(29,30)10-8-24(35)17-21-6-4-7-23(16-21)25-20-31-26-18-22(9-14-34(25)26)19-32-36-15-5-13-33-11-2-1-3-12-33/h4,6-7,9,14,16,18-20H,1-3,5,8,10-13,15,17H2/b32-19+ |
| InChIKey | IFIZXDLAVFEHGD-BIZUNTBRSA-N |
| XLogP | 5.68 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|