C24H22F3N5O2 — CID 58081534
5,5,5-trifluoro-1-[3-[7-[(E)-(3-methylimidazol-4-yl)methoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081534) has the molecular formula C24H22F3N5O2 and a molecular weight of 469.47 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(E)-(3-methylimidazol-4-yl)methoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(E)-(3-methylimidazol-4-yl)methoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081534 |
| Molecular Formula | C24H22F3N5O2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(E)-(3-methylimidazol-4-yl)methoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | Cn1cncc1CO/N=C/c1ccn2c(-c3cccc(CC(=O)CCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C24H22F3N5O2/c1-31-16-28-13-20(31)15-34-30-12-18-6-8-32-22(14-29-23(32)11-18)19-4-2-3-17(9-19)10-21(33)5-7-24(25,26)27/h2-4,6,8-9,11-14,16H,5,7,10,15H2,1H3/b30-12+ |
| InChIKey | LJAZEGOOYFYFBH-PNQUVVCRSA-N |
| XLogP | 4.74 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|