C28H33F3N4O3 — CID 58081540
5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methoxypiperidin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081540) has the molecular formula C28H33F3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methoxypiperidin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methoxypiperidin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081540 |
| Molecular Formula | C28H33F3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-3-(4-methoxypiperidin-1-yl)propoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | COC1CCN(CCCO/N=C\c2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)CC1 |
| InChI | InChI=1S/C28H33F3N4O3/c1-37-25-8-12-34(13-9-25)11-3-15-38-33-19-22-7-14-35-26(20-32-27(35)18-22)23-5-2-4-21(16-23)17-24(36)6-10-28(29,30)31/h2,4-5,7,14,16,18-20,25H,3,6,8-13,15,17H2,1H3/b33-19- |
| InChIKey | GCDHNUFSRJUSOM-APTWKGOFSA-N |
| XLogP | 5.31 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|