C13H17N5O — CID 58081568
12-methyl-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one (PubChem CID 58081568) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 12-methyl-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one.
| Compound Name | 12-methyl-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 58081568 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 12-methyl-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
| SMILES | CCCCCn1c2c(c(=O)n3c(C)nnc13)CC=N2 |
| InChI | InChI=1S/C13H17N5O/c1-3-4-5-8-17-11-10(6-7-14-11)12(19)18-9(2)15-16-13(17)18/h7H,3-6,8H2,1-2H3 |
| InChIKey | YGIXRKWPBLMRGA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|