C20H26N3S3+ — CID 58082001
(2Z)-2-[(2Z,4E)-5-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)penta-2,4-dienylidene]-3,4-dimethyl-1,3-thiazole (PubChem CID 58082001) has the molecular formula C20H26N3S3+ and a molecular weight of 404.65 g/mol. Its IUPAC name is (2Z)-2-[(2Z,4E)-5-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)penta-2,4-dienylidene]-3,4-dimethyl-1,3-thiazole.
| Compound Name | (2Z)-2-[(2Z,4E)-5-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)penta-2,4-dienylidene]-3,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 58082001 |
| Molecular Formula | C20H26N3S3+ |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (2Z)-2-[(2Z,4E)-5-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)penta-2,4-dienylidene]-3,4-dimethyl-1,3-thiazole |
| SMILES | CC1=CS/C(=C\C=C(\C=C\c2scc(C)[n+]2C)C2SC=C(C)N2C)N1C |
| InChI | InChI=1S/C20H26N3S3/c1-14-11-24-18(21(14)4)9-7-17(20-23(6)16(3)13-26-20)8-10-19-22(5)15(2)12-25-19/h7-13,20H,1-6H3/q+1 |
| InChIKey | RFGSGCJKNHKSJL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|