About N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine
N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine (PubChem CID 58082598) has the molecular formula C19H23F2N3O2
and a molecular weight of 363.41 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine |
| PubChem CID | 58082598 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine |
| SMILES | FC1(F)CCC(Nc2ncc3cccc(OC4CCOCC4)c3n2)CC1 |
| InChI | InChI=1S/C19H23F2N3O2/c20-19(21)8-4-14(5-9-19)23-18-22-12-13-2-1-3-16(17(13)24-18)26-15-6-10-25-11-7-15/h1-3,12,14-15H,4-11H2,(H,22,23,24) |
| InChIKey | RRLWBTFXCVKNEX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine?
The IUPAC name of N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine (CID 58082598) is N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine is FC1(F)CCC(Nc2ncc3cccc(OC4CCOCC4)c3n2)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine?
The InChIKey is RRLWBTFXCVKNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F2N3O2/c20-19(21)8-4-14(5-9-19)23-18-22-12-13-2-1-3-16(17(13)24-18)26-15-6-10-25-11-7-15/h1-3,12,14-15H,4-11H2,(H,22,23,24).
What are the key properties of N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine?
N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine has a molecular weight of 363.41 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-8-(oxan-4-yloxy)quinazolin-2-amine is sourced from PubChem (CID 58082598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).