C23H26FN3O3S — CID 58082918
(6S)-2-amino-6-[5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one (PubChem CID 58082918) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is (6S)-2-amino-6-[5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-[5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 58082918 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (6S)-2-amino-6-[5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]-2-fluorophenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
| SMILES | CN1C(=O)C(C)(C)[C@@](C)(c2cc(CC3CS(=O)(=O)c4ccccc43)ccc2F)N=C1N |
| InChI | InChI=1S/C23H26FN3O3S/c1-22(2)20(28)27(4)21(25)26-23(22,3)17-12-14(9-10-18(17)24)11-15-13-31(29,30)19-8-6-5-7-16(15)19/h5-10,12,15H,11,13H2,1-4H3,(H2,25,26)/t15?,23-/m1/s1 |
| InChIKey | ONDDFPNFBDGMBA-RYDFDWSBSA-N |
| XLogP | 2.97 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |