About 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one
6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one (PubChem CID 58082962) has the molecular formula C10H7FO2
and a molecular weight of 178.16 g/mol. Its IUPAC name is 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one.
Molecular Properties
| Compound Name | 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one |
| PubChem CID | 58082962 |
| Molecular Formula | C10H7FO2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one |
| SMILES | O=C1c2ccc(F)cc2OC12CC2 |
| InChI | InChI=1S/C10H7FO2/c11-6-1-2-7-8(5-6)13-10(3-4-10)9(7)12/h1-2,5H,3-4H2 |
| InChIKey | GIZDPSNQCCUOFG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one?
The IUPAC name of 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one (CID 58082962) is 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one.
What is the SMILES notation for 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one?
The canonical SMILES for 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one is O=C1c2ccc(F)cc2OC12CC2.
What is the InChIKey of 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one?
The InChIKey is GIZDPSNQCCUOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FO2/c11-6-1-2-7-8(5-6)13-10(3-4-10)9(7)12/h1-2,5H,3-4H2.
What are the key properties of 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one?
6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one has a molecular weight of 178.16 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorospiro[1-benzofuran-2,1'-cyclopropane]-3-one is sourced from PubChem (CID 58082962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).