C36H42O5 — CID 58083060
2-[5-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-yl]acetaldehyde (PubChem CID 58083060) has the molecular formula C36H42O5 and a molecular weight of 554.73 g/mol. Its IUPAC name is 2-[5-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-yl]acetaldehyde.
| Compound Name | 2-[5-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 58083060 |
| Molecular Formula | C36H42O5 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 2-[5-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]-2-methylphenyl]methoxy]spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-yl]acetaldehyde |
| SMILES | Cc1cc(OCC2COC(C)(C)OC2)cc(C)c1-c1cccc(COc2ccc3c(c2)CC2(CC2)C3CC=O)c1C |
| InChI | InChI=1S/C36H42O5/c1-23-15-30(38-19-26-20-40-35(4,5)41-21-26)16-24(2)34(23)31-8-6-7-27(25(31)3)22-39-29-9-10-32-28(17-29)18-36(12-13-36)33(32)11-14-37/h6-10,14-17,26,33H,11-13,18-22H2,1-5H3 |
| InChIKey | KDCIIUYSSPVGPK-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|