C22H20Cl2F2N4 — CID 58083348
(3R,4S)-3-[4-cyclopropyl-5-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]-4-(3,4-difluorophenyl)piperidine (PubChem CID 58083348) has the molecular formula C22H20Cl2F2N4 and a molecular weight of 449.33 g/mol. Its IUPAC name is (3R,4S)-3-[4-cyclopropyl-5-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]-4-(3,4-difluorophenyl)piperidine.
| Compound Name | (3R,4S)-3-[4-cyclopropyl-5-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]-4-(3,4-difluorophenyl)piperidine |
|---|---|
| PubChem CID | 58083348 |
| Molecular Formula | C22H20Cl2F2N4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (3R,4S)-3-[4-cyclopropyl-5-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]-4-(3,4-difluorophenyl)piperidine |
| SMILES | Fc1ccc([C@H]2CCNC[C@@H]2c2nnc(-c3cccc(Cl)c3Cl)n2C2CC2)cc1F |
| InChI | InChI=1S/C22H20Cl2F2N4/c23-17-3-1-2-15(20(17)24)21-28-29-22(30(21)13-5-6-13)16-11-27-9-8-14(16)12-4-7-18(25)19(26)10-12/h1-4,7,10,13-14,16,27H,5-6,8-9,11H2/t14-,16+/m1/s1 |
| InChIKey | JQZSFNODPKCNHQ-ZBFHGGJFSA-N |
| XLogP | 5.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |