About 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol
4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol (PubChem CID 58083466) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol |
| PubChem CID | 58083466 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C13H13NO4/c15-10-3-1-8(5-12(10)17)7-14-9-2-4-11(16)13(18)6-9/h1-6,14-18H,7H2 |
| InChIKey | BOLQVOXQHFRJPR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol?
The IUPAC name of 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol (CID 58083466) is 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol.
What is the SMILES notation for 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol?
The canonical SMILES for 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol is Oc1ccc(CNc2ccc(O)c(O)c2)cc1O.
What is the InChIKey of 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol?
The InChIKey is BOLQVOXQHFRJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c15-10-3-1-8(5-12(10)17)7-14-9-2-4-11(16)13(18)6-9/h1-6,14-18H,7H2.
What are the key properties of 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol?
4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol has a molecular weight of 247.25 g/mol, XLogP of 2.12, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dihydroxyanilino)methyl]benzene-1,2-diol is sourced from PubChem (CID 58083466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).