About 3-(3-oxobutyl)-1,4-dioxane-2,5-dione
3-(3-oxobutyl)-1,4-dioxane-2,5-dione (PubChem CID 58083912) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-(3-oxobutyl)-1,4-dioxane-2,5-dione.
Molecular Properties
| Compound Name | 3-(3-oxobutyl)-1,4-dioxane-2,5-dione |
| PubChem CID | 58083912 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(3-oxobutyl)-1,4-dioxane-2,5-dione |
| SMILES | CC(=O)CCC1OC(=O)COC1=O |
| InChI | InChI=1S/C8H10O5/c1-5(9)2-3-6-8(11)12-4-7(10)13-6/h6H,2-4H2,1H3 |
| InChIKey | INBWEONNDMBWQD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-oxobutyl)-1,4-dioxane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-oxobutyl)-1,4-dioxane-2,5-dione?
The IUPAC name of 3-(3-oxobutyl)-1,4-dioxane-2,5-dione (CID 58083912) is 3-(3-oxobutyl)-1,4-dioxane-2,5-dione.
What is the SMILES notation for 3-(3-oxobutyl)-1,4-dioxane-2,5-dione?
The canonical SMILES for 3-(3-oxobutyl)-1,4-dioxane-2,5-dione is CC(=O)CCC1OC(=O)COC1=O.
What is the InChIKey of 3-(3-oxobutyl)-1,4-dioxane-2,5-dione?
The InChIKey is INBWEONNDMBWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-5(9)2-3-6-8(11)12-4-7(10)13-6/h6H,2-4H2,1H3.
What are the key properties of 3-(3-oxobutyl)-1,4-dioxane-2,5-dione?
3-(3-oxobutyl)-1,4-dioxane-2,5-dione has a molecular weight of 186.16 g/mol, XLogP of -0.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-oxobutyl)-1,4-dioxane-2,5-dione is sourced from PubChem (CID 58083912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).