C10H16BrO3P — CID 58084288
8-bromo-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane (PubChem CID 58084288) has the molecular formula C10H16BrO3P and a molecular weight of 295.11 g/mol. Its IUPAC name is 8-bromo-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane.
| Compound Name | 8-bromo-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 58084288 |
| Molecular Formula | C10H16BrO3P |
| Molecular Weight | 295.11 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 8-bromo-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)P3Br)O2 |
| InChI | InChI=1S/C10H16BrO3P/c1-7-5-9(3)14-8(2,12-7)6-10(4,13-7)15(9)11/h5-6H2,1-4H3 |
| InChIKey | WMVHJMCFOTUXPP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.11 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|