C61H43N4P — CID 58084568
2-N,2-N,2-N',2-N',7-N',7-N'-hexakis-phenyl-7-(phosphanylideneamino)-9,9'-spirobi[fluorene]-2,2',7'-triamine (PubChem CID 58084568) has the molecular formula C61H43N4P and a molecular weight of 863.02 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N',7-N',7-N'-hexakis-phenyl-7-(phosphanylideneamino)-9,9'-spirobi[fluorene]-2,2',7'-triamine.
| Compound Name | 2-N,2-N,2-N',2-N',7-N',7-N'-hexakis-phenyl-7-(phosphanylideneamino)-9,9'-spirobi[fluorene]-2,2',7'-triamine |
|---|---|
| PubChem CID | 58084568 |
| Molecular Formula | C61H43N4P |
| Molecular Weight | 863.02 g/mol |
| Exact Mass | 862.32 |
| IUPAC Name | 2-N,2-N,2-N',2-N',7-N',7-N'-hexakis-phenyl-7-(phosphanylideneamino)-9,9'-spirobi[fluorene]-2,2',7'-triamine |
| SMILES | [H]/P=N\c1ccc2c(c1)C1(c3cc(N(c4ccccc4)c4ccccc4)ccc3-2)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C61H43N4P/c66-62-43-31-35-53-54-36-32-50(63(44-19-7-1-8-20-44)45-21-9-2-10-22-45)40-58(54)61(57(53)39-43)59-41-51(64(46-23-11-3-12-24-46)47-25-13-4-14-26-47)33-37-55(59)56-38-34-52(42-60(56)61)65(48-27-15-5-16-28-48)49-29-17-6-18-30-49/h1-42,66H |
| InChIKey | HBZVXUQZYGOCLC-UHFFFAOYSA-N |
| XLogP | 17.40 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.02 |
| LogP ≤ 5 | 17.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|