C29H26IrNO2S- — CID 58084656
1,3-diphenylpropane-1,3-diol;iridium;2-(3-methanidyl-1-benzothiophen-2-yl)pyridine (PubChem CID 58084656) has the molecular formula C29H26IrNO2S- and a molecular weight of 644.82 g/mol. Its IUPAC name is 1,3-diphenylpropane-1,3-diol;iridium;2-(3-methanidyl-1-benzothiophen-2-yl)pyridine.
| Compound Name | 1,3-diphenylpropane-1,3-diol;iridium;2-(3-methanidyl-1-benzothiophen-2-yl)pyridine |
|---|---|
| PubChem CID | 58084656 |
| Molecular Formula | C29H26IrNO2S- |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 645.13 |
| IUPAC Name | 1,3-diphenylpropane-1,3-diol;iridium;2-(3-methanidyl-1-benzothiophen-2-yl)pyridine |
| SMILES | OC(CC(O)c1ccccc1)c1ccccc1.[CH2-]c1c(-c2ccccn2)sc2ccccc12.[Ir] |
| InChI | InChI=1S/C15H16O2.C14H10NS.Ir/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;1-10-11-6-2-3-8-13(11)16-14(10)12-7-4-5-9-15-12;/h1-10,14-17H,11H2;2-9H,1H2;/q;-1; |
| InChIKey | PYNRSQRMROYANX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|